Compare commits

..

1 Commits

Author SHA1 Message Date
c02f1cfb4c Implementation of polling app 2026-03-18 17:41:37 +01:00
5 changed files with 204 additions and 370 deletions

200
PollingApp.html Normal file
View File

@@ -0,0 +1,200 @@
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="UTF-8">
<title>PeertoPeer Poll up to 14 users (no vote loops)</title>
<style>
body {font-family:Arial,Helvetica,sans-serif; margin:20px;}
#options li {margin:5px 0;}
button {margin-left:5px;}
</style>
</head>
<body>
<h2>PeertoPeer Poll (max14 participants)</h2>
<div id="setup">
<label>Your Peer ID: <input id="myId" readonly size="30"></label><br><br>
<label>Room host ID (leave empty if you are the first client):
<input id="hostId" placeholder="host peer id">
</label>
<button id="joinBtn">Join / Create Room</button>
<p id="status"></p>
</div>
<hr>
<h3>Poll</h3>
<ul id="options"></ul>
<input id="newOption" placeholder="New option text">
<button id="addOptionBtn">Add option</button>
<script src="https://unpkg.com/peerjs@1.5.4/dist/peerjs.min.js"></script>
<script>
/* ---------- 1. Initialise PeerJS ---------- */
const peer = new Peer(); // public signalling server
const myIdInput = document.getElementById('myId');
const statusEl = document.getElementById('status');
let isHost = false; // true for the first client
let connections = []; // all open DataConnections
let knownPeers = new Set(); // IDs of every peer we know (including host)
peer.on('open', id => {
myIdInput.value = id;
statusEl.textContent = 'Enter a host ID (or leave empty) and click Join.';
});
/* ---------- 2. Accept incoming connections (host side) ---------- */
peer.on('connection', incoming => {
registerConnection(incoming);
});
/* ---------- 3. Join / create a room ---------- */
document.getElementById('joinBtn').onclick = () => {
const hostId = document.getElementById('hostId').value.trim();
if (hostId) {
isHost = false;
connectToPeer(hostId);
statusEl.textContent = `Connecting to host ${hostId}`;
} else {
isHost = true;
knownPeers.add(peer.id);
statusEl.textContent = 'Room created share this Peer ID with others.';
}
};
/* ---------- 4. Helper: connect to a remote peer ---------- */
function connectToPeer(peerId) {
if (knownPeers.has(peerId)) return;
const conn = peer.connect(peerId);
registerConnection(conn);
}
/* ---------- 5. Register a DataConnection ---------- */
function registerConnection(conn) {
if (!conn) return;
connections.push(conn);
knownPeers.add(conn.peer);
conn.on('open', () => {
// 1⃣ Send full poll state
conn.send({type: 'full', payload: poll, msgId: crypto.randomUUID()});
// 2⃣ If we are the host, tell the newcomer about other peers
if (isHost) {
const others = Array.from(knownPeers).filter(id => id !== conn.peer && id !== peer.id);
if (others.length) conn.send({type: 'peer-list', payload: others, msgId: crypto.randomUUID()});
}
});
conn.on('data', data => handleMessage(data, conn.peer));
conn.on('close', () => {
connections = connections.filter(c => c !== conn);
knownPeers.delete(conn.peer);
});
}
/* ---------- 6. Shared poll state ---------- */
let poll = {options: []}; // each option: {id, text, votes}
/* ---------- 7. Track my own votes ---------- */
const myVotes = new Set(); // option.id values
/* ---------- 8. Remember which messages we already processed ---------- */
const seenMsgIds = new Set();
/* ---------- 9. Broadcast helper (skip the sender) ---------- */
function broadcast(msg, except = null) {
connections.forEach(c => {
if (c.open && c.peer !== except) c.send(msg);
});
}
/* ---------- 10. Message handling ---------- */
function handleMessage(msg, senderId) {
// Ignore duplicates
if (seenMsgIds.has(msg.msgId)) return;
seenMsgIds.add(msg.msgId);
switch (msg.type) {
case 'full':
poll = msg.payload;
render();
break;
case 'add':
poll.options.push(msg.payload);
render();
broadcast(msg, senderId); // forward once
break;
case 'vote':
const opt = poll.options.find(o => o.id === msg.payload.id);
if (opt) opt.votes++;
render();
broadcast(msg, senderId);
break;
case 'peer-list':
msg.payload.forEach(id => {
if (id !== peer.id && !knownPeers.has(id)) connectToPeer(id);
});
break;
}
}
/* ---------- 11. UI rendering ---------- */
function render() {
const ul = document.getElementById('options');
ul.innerHTML = '';
poll.options.forEach(opt => {
const li = document.createElement('li');
li.textContent = `${opt.text} ${opt.votes} vote(s)`;
const btn = document.createElement('button');
btn.textContent = myVotes.has(opt.id) ? 'Voted' : 'Vote';
btn.disabled = myVotes.has(opt.id);
btn.onclick = () => {
// Record locally prevents doubleclick on the same client
myVotes.add(opt.id);
btn.textContent = 'Voted';
btn.disabled = true;
const voteMsg = {
type: 'vote',
payload: {id: opt.id},
msgId: crypto.randomUUID()
};
// Apply locally first
opt.votes++;
render();
// Send to all peers
broadcast(voteMsg);
};
li.appendChild(btn);
ul.appendChild(li);
});
}
/* ---------- 12. Add new option ---------- */
document.getElementById('addOptionBtn').onclick = () => {
const txt = document.getElementById('newOption').value.trim();
if (!txt) return;
const option = {id: crypto.randomUUID(), text: txt, votes: 0};
poll.options.push(option);
render();
const addMsg = {
type: 'add',
payload: option,
msgId: crypto.randomUUID()
};
broadcast(addMsg);
document.getElementById('newOption').value = '';
};
</script>
</body>
</html>

View File

@@ -1,14 +1,7 @@
# P2P Poll App
P2P Poll - Minimal GUN-based Scaffolding
This is a very simple polling app using peerjs.
It runs as a single HTML file and can handle multiple users in one poll room.
The app once open is self explanatory.
App created with the help of GPTOSS120B.
What this is
- A tiny peer-to-peer polling app implemented with vanilla JS and GUN (a decentralized, CRDT-friendly database).
- No central server for poll data. Peers connect and synchronize the poll in real-time.
Notes
- This scaffold uses GUNs browser-based peer-to-peer data replication.
- You can extend with:
- Persistent storage on each peer
- Better conflict resolution UI
- Optional signaling server for explicit peer discovery

200
app.js
View File

@@ -1,200 +0,0 @@
// Minimal GUN-based P2P Poll scaffold (vanilla JS)
(function() {
// Initialize GUN (no server needed; can optionally connect to a relay server)
// If you want a local-only node for prototyping: Gun()
// If you want to use a signaling server for discovery, pass a list of peers to Gun().opt({peers: [...]})
const gun = Gun();
// DOM helpers
const pollSection = document.getElementById('poll');
const pollIdInput = document.getElementById('pollId');
const loadPollBtn = document.getElementById('loadPollBtn');
const createPollBtn = document.getElementById('createPollBtn');
const pollTitleInput = document.getElementById('pollTitle');
const setTitleBtn = document.getElementById('setTitleBtn');
const optionsDiv = document.getElementById('options');
const newOptionInput = document.getElementById('newOption');
const addOptionBtn = document.getElementById('addOptionBtn');
const totalVotesSpan = document.getElementById('totalVotes');
const pollIdDisplay = document.getElementById('pollIdDisplay');
let currentPollId = null;
let pollsRef = null; // Gun node for /polls/{pollId}
let pollData = null; // local cache
// Helpers
function renderOptionList(options) {
optionsDiv.innerHTML = '';
const keys = Object.keys(options || {});
if (keys.length === 0) {
optionsDiv.innerHTML = '<p>No options yet. Add one below.</p>';
return;
}
keys.forEach((optId) => {
const opt = options[optId];
const el = document.createElement('div');
el.className = 'option';
el.innerHTML = `
<span class="text">${opt.text}</span>
<button data-optid="${optId}" class="voteBtn">Vote (${opt.votes || 0})</button>
`;
optionsDiv.appendChild(el);
});
}
function updateTotalVotes() {
const opts = pollData && pollData.options ? pollData.options : {};
const total = Object.values(opts).reduce((sum, o) => sum + (o.votes || 0), 0);
totalVotesSpan.textContent = total;
}
// Load existing poll and subscribe to changes
function loadPoll(pollId) {
if (!pollId) return;
currentPollId = pollId;
pollIdDisplay.textContent = pollId;
pollsRef = gun.get('polls').get(pollId);
// Initialize structure if new poll
pollsRef.get('title').put('Untitled Poll');
pollsRef.get('options').put({}); // ensure map exists
// Real-time updates: listen to changes
pollsRef.get('title').on((title) => {
pollTitleInput.value = title || '';
});
pollsRef.on((data) => {
// data is the entire poll node if subscribed; but we explore explicit fields
});
// For options map
pollsRef.get('options').on((opts) => {
// opts is the entire options map; convert to plain object
const optionsObj = toPlainObject(opts);
pollData = {
title: null,
options: optionsObj
};
renderOptionList(optionsObj);
updateTotalVotes();
});
// Also listen for title changes separately (in case some clients push via title path)
pollsRef.get('title').on((title) => {
pollTitleInput.value = title || '';
});
// Show UI
document.getElementById('setup').style.display = 'none';
pollSection.style.display = 'block';
}
// Create a new poll
function createPoll() {
const pollId = pollIdInput.value.trim();
if (!pollId) {
alert('Please enter a poll ID to create.');
return;
}
currentPollId = pollId;
// Initialize poll
pollsRef = gun.get('polls').get(pollId);
pollsRef.put({
title: 'New Poll',
});
pollsRef.get('options').put({}); // ensure map exists
// reflect in UI
pollIdDisplay.textContent = pollId;
pollTitleInput.value = 'New Poll';
pollSection.style.display = 'block';
document.getElementById('setup').style.display = 'none';
}
// Add option
function addOption() {
if (!pollsRef) {
alert('Load or create a poll first.');
return;
}
const text = newOptionInput.value.trim();
if (!text) return;
const optionId = 'opt_' + Date.now();
pollsRef.get('options').get(optionId).put({ text, votes: 0 });
newOptionInput.value = '';
}
// Set title
function setTitle() {
if (!pollsRef) return;
const title = pollTitleInput.value.trim() || 'Untitled';
pollsRef.get('title').put(title);
}
// Vote handler (delegated)
function handleVoteClick(e) {
if (e.target.classList.contains('voteBtn')) {
const optId = e.target.getAttribute('data-optid');
if (!optId || !pollsRef) return;
const optRef = pollsRef.get('options').get(optId);
// Increment votes locally
optRef.get('votes').once((v) => {
const current = v || 0;
optRef.put({ votes: current + 1 });
});
// UI will update via the on() listener on options map
}
}
// Utilities
function toPlainObject(obj) {
// Gun emits special proxy-like objects; convert to plain object
if (!obj) return {};
// If it's already a plain object, return
if (typeof obj !== 'object') return {};
// Gun events deliver object-like; attempt shallow copy
try {
const copy = JSON.parse(JSON.stringify(obj));
return copy;
} catch (e) {
// Fallback: return as-is if cannot stringify
return obj;
}
}
// Event bindings
loadPollBtn.addEventListener('click', () => {
const id = pollIdInput.value.trim();
if (!id) {
alert('Enter a Poll ID to load.');
return;
}
loadPoll(id);
});
createPollBtn.addEventListener('click', () => {
createPoll();
});
addOptionBtn.addEventListener('click', addOption);
newOptionInput.addEventListener('keydown', (ev) => {
if (ev.key === 'Enter') addOption();
});
setTitleBtn.addEventListener('click', setTitle);
// Delegate vote clicks
optionsDiv.addEventListener('click', handleVoteClick);
// Initialize: optionally auto-create a poll if URL param present
// Example: ?pollId=my-poll-123
const urlParams = new URLSearchParams(window.location.search);
const autoPoll = urlParams.get('pollId');
if (autoPoll) {
pollIdInput.value = autoPoll;
loadPoll(autoPoll);
}
})();

View File

@@ -1,55 +0,0 @@
<!doctype html>
<html lang="en">
<head>
<meta charset="UTF-8" />
<meta name="viewport" content="width=device-width, initial-scale=1.0"/>
<title>P2P Poll</title>
<link rel="stylesheet" href="styles.css" />
<!-- Gun.js via CDN for quick start -->
<script src="https://unpkg.com/gun/gun.js"></script>
</head>
<body>
<div class="container">
<h1>P2P Poll</h1>
<section id="setup" class="card">
<h2>Start or Join Poll</h2>
<div class="field">
<label for="pollId">Poll ID (share with peer):</label>
<input id="pollId" type="text" placeholder="e.g. my-poll-123" />
</div>
<button id="loadPollBtn">Load Poll</button>
<button id="createPollBtn">Create New Poll</button>
<p class="note">Tip: You can run two instances and connect by using the same Poll ID.</p>
</section>
<section id="poll" class="card" style="display:none;">
<h2>Poll</h2>
<div class="field">
<label for="pollTitle">Poll Title</label>
<input id="pollTitle" type="text" placeholder="Poll Title" />
<button id="setTitleBtn">Set Title</button>
</div>
<div id="options" class="options">
<!-- dynamic options will render here -->
</div>
<div class="field">
<input id="newOption" type="text" placeholder="Add a new option" />
<button id="addOptionBtn">Add Option</button>
</div>
<div class="summary">
<p>Total votes: <span id="totalVotes">0</span></p>
</div>
<div class="share">
<p>Share Poll ID with peer: <code id="pollIdDisplay"></code></p>
</div>
</section>
</div>
<script src="app.js"></script>
</body>
</html>

View File

@@ -1,104 +0,0 @@
:root {
--bg: #0f1220;
--card: #1a1740;
--text: #e8e3ff;
--muted: #b8a7d2;
--accent: #6bd3ff;
}
* {
box-sizing: border-box;
}
html,
body {
margin: 0;
padding: 0;
font-family: sans-serif;
background: #0b0a14;
color: #fff;
height: 100%;
}
.container {
max-width: 700px;
margin: 40px auto;
padding: 0 16px;
}
.card {
background: #1f1740;
border-radius: 12px;
padding: 16px;
margin-bottom: 14px;
border: 1px solid #2a1950;
}
.field {
margin-bottom: 12px;
display: flex;
gap: 8px;
align-items: center;
}
label {
min-width: 180px;
}
input[type="text"] {
flex: 1;
padding: 8px;
border-radius: 6px;
border: 1px solid #5a2d8a;
background: #2a174f;
color: #fff;
}
button {
padding: 8px 12px;
border-radius: 6px;
border: none;
background: #6bd3ff;
color: #04152a;
font-weight: bold;
cursor: pointer;
}
button:hover {
opacity: 0.95;
}
.options {
display: flex;
flex-direction: column;
gap: 8px;
margin-top: 6px;
}
.option {
display: flex;
justify-content: space-between;
align-items: center;
padding: 8px;
background: #2a174f;
border: 1px solid #40217a;
border-radius: 6px;
}
.option .text {
flex: 1;
}
.share {
font-size: 0.9em;
color: var(--muted);
}
.note {
color: #c8b5ff;
font-size: 0.9em;
}
.total {
font-weight: bold;
}