* init p2p-poll

2026-03-18 20:09:20 +01:00
12 changed files with 10295 additions and 207 deletions
--- a/PollingApp.html
+++ b/PollingApp.html
@@ -1,200 +0,0 @@
-<!DOCTYPE html>
-<html lang="en">
-<head>
-<meta charset="UTF-8">
-<title>Peer‑to‑Peer Poll – up to 14 users (no vote loops)</title>
-<style>
-  body {font-family:Arial,Helvetica,sans-serif; margin:20px;}
-  #options li {margin:5px 0;}
-  button {margin-left:5px;}
-</style>
-</head>
-<body>
-
-<h2>Peer‑to‑Peer Poll (max 14 participants)</h2>
-
-<div id="setup">
-  <label>Your Peer ID: <input id="myId" readonly size="30"></label><br><br>
-  <label>Room host ID (leave empty if you are the first client):
-    <input id="hostId" placeholder="host peer id">
-  </label>
-  <button id="joinBtn">Join / Create Room</button>
-  <p id="status"></p>
-</div>
-
-<hr>
-
-<h3>Poll</h3>
-<ul id="options"></ul>
-
-<input id="newOption" placeholder="New option text">
-<button id="addOptionBtn">Add option</button>
-
-<script src="https://unpkg.com/peerjs@1.5.4/dist/peerjs.min.js"></script>
-<script>
-/* ---------- 1. Initialise PeerJS ---------- */
-const peer = new Peer();                     // public signalling server
-const myIdInput = document.getElementById('myId');
-const statusEl   = document.getElementById('status');
-
-let isHost = false;                          // true for the first client
-let connections = [];                        // all open DataConnections
-let knownPeers = new Set();                  // IDs of every peer we know (including host)
-
-peer.on('open', id => {
-  myIdInput.value = id;
-  statusEl.textContent = 'Enter a host ID (or leave empty) and click Join.';
-});
-
-/* ---------- 2. Accept incoming connections (host side) ---------- */
-peer.on('connection', incoming => {
-  registerConnection(incoming);
-});
-
-/* ---------- 3. Join / create a room ---------- */
-document.getElementById('joinBtn').onclick = () => {
-  const hostId = document.getElementById('hostId').value.trim();
-  if (hostId) {
-    isHost = false;
-    connectToPeer(hostId);
-    statusEl.textContent = `Connecting to host ${hostId}…`;
-  } else {
-    isHost = true;
-    knownPeers.add(peer.id);
-    statusEl.textContent = 'Room created – share this Peer ID with others.';
-  }
-};
-
-/* ---------- 4. Helper: connect to a remote peer ---------- */
-function connectToPeer(peerId) {
-  if (knownPeers.has(peerId)) return;
-  const conn = peer.connect(peerId);
-  registerConnection(conn);
-}
-
-/* ---------- 5. Register a DataConnection ---------- */
-function registerConnection(conn) {
-  if (!conn) return;
-  connections.push(conn);
-  knownPeers.add(conn.peer);
-
-  conn.on('open', () => {
-    // 1️⃣ Send full poll state
-    conn.send({type: 'full', payload: poll, msgId: crypto.randomUUID()});
-
-    // 2️⃣ If we are the host, tell the newcomer about other peers
-    if (isHost) {
-      const others = Array.from(knownPeers).filter(id => id !== conn.peer && id !== peer.id);
-      if (others.length) conn.send({type: 'peer-list', payload: others, msgId: crypto.randomUUID()});
-    }
-  });
-
-  conn.on('data', data => handleMessage(data, conn.peer));
-  conn.on('close', () => {
-    connections = connections.filter(c => c !== conn);
-    knownPeers.delete(conn.peer);
-  });
-}
-
-/* ---------- 6. Shared poll state ---------- */
-let poll = {options: []};   // each option: {id, text, votes}
-
-/* ---------- 7. Track my own votes ---------- */
-const myVotes = new Set();   // option.id values
-
-/* ---------- 8. Remember which messages we already processed ---------- */
-const seenMsgIds = new Set();
-
-/* ---------- 9. Broadcast helper (skip the sender) ---------- */
-function broadcast(msg, except = null) {
-  connections.forEach(c => {
-    if (c.open && c.peer !== except) c.send(msg);
-  });
-}
-
-/* ---------- 10. Message handling ---------- */
-function handleMessage(msg, senderId) {
-  // Ignore duplicates
-  if (seenMsgIds.has(msg.msgId)) return;
-  seenMsgIds.add(msg.msgId);
-
-  switch (msg.type) {
-    case 'full':
-      poll = msg.payload;
-      render();
-      break;
-
-    case 'add':
-      poll.options.push(msg.payload);
-      render();
-      broadcast(msg, senderId);   // forward once
-      break;
-
-    case 'vote':
-      const opt = poll.options.find(o => o.id === msg.payload.id);
-      if (opt) opt.votes++;
-      render();
-      broadcast(msg, senderId);
-      break;
-
-    case 'peer-list':
-      msg.payload.forEach(id => {
-        if (id !== peer.id && !knownPeers.has(id)) connectToPeer(id);
-      });
-      break;
-  }
-}
-
-/* ---------- 11. UI rendering ---------- */
-function render() {
-  const ul = document.getElementById('options');
-  ul.innerHTML = '';
-  poll.options.forEach(opt => {
-    const li = document.createElement('li');
-    li.textContent = `${opt.text} – ${opt.votes} vote(s)`;
-
-    const btn = document.createElement('button');
-    btn.textContent = myVotes.has(opt.id) ? 'Voted' : 'Vote';
-    btn.disabled = myVotes.has(opt.id);
-    btn.onclick = () => {
-      // Record locally – prevents double‑click on the same client
-      myVotes.add(opt.id);
-      btn.textContent = 'Voted';
-      btn.disabled = true;
-
-      const voteMsg = {
-        type: 'vote',
-        payload: {id: opt.id},
-        msgId: crypto.randomUUID()
-      };
-      // Apply locally first
-      opt.votes++;
-      render();
-      // Send to all peers
-      broadcast(voteMsg);
-    };
-    li.appendChild(btn);
-    ul.appendChild(li);
-  });
-}
-
-/* ---------- 12. Add new option ---------- */
-document.getElementById('addOptionBtn').onclick = () => {
-  const txt = document.getElementById('newOption').value.trim();
-  if (!txt) return;
-  const option = {id: crypto.randomUUID(), text: txt, votes: 0};
-  poll.options.push(option);
-  render();
-
-  const addMsg = {
-    type: 'add',
-    payload: option,
-    msgId: crypto.randomUUID()
-  };
-  broadcast(addMsg);
-  document.getElementById('newOption').value = '';
-};
-</script>
-</body>
-</html>
-
--- a/README.md
+++ b/README.md
@@ -1,7 +1 @@
-# P2P Poll App
-
-This is a very simple polling app using peerjs.
-It runs as a single HTML file and can handle multiple users in one poll room.
-The app once open is self explanatory.
-App created with the help of GPTOSS120B.
-
+# P2P Poll App
--- a/p2p-poll/.gitignore
+++ b/p2p-poll/.gitignore
@@ -0,0 +1,24 @@
+# Nuxt dev/build outputs
+.output
+.data
+.nuxt
+.nitro
+.cache
+dist
+
+# Node dependencies
+node_modules
+
+# Logs
+logs
+*.log
+
+# Misc
+.DS_Store
+.fleet
+.idea
+
+# Local env files
+.env
+.env.*
+!.env.example
--- a/p2p-poll/README.md
+++ b/p2p-poll/README.md
@@ -0,0 +1,75 @@
+# Nuxt Minimal Starter
+
+Look at the [Nuxt documentation](https://nuxt.com/docs/getting-started/introduction) to learn more.
+
+## Setup
+
+Make sure to install dependencies:
+
+```bash
+# npm
+npm install
+
+# pnpm
+pnpm install
+
+# yarn
+yarn install
+
+# bun
+bun install
+```
+
+## Development Server
+
+Start the development server on `http://localhost:3000`:
+
+```bash
+# npm
+npm run dev
+
+# pnpm
+pnpm dev
+
+# yarn
+yarn dev
+
+# bun
+bun run dev
+```
+
+## Production
+
+Build the application for production:
+
+```bash
+# npm
+npm run build
+
+# pnpm
+pnpm build
+
+# yarn
+yarn build
+
+# bun
+bun run build
+```
+
+Locally preview production build:
+
+```bash
+# npm
+npm run preview
+
+# pnpm
+pnpm preview
+
+# yarn
+yarn preview
+
+# bun
+bun run preview
+```
+
+Check out the [deployment documentation](https://nuxt.com/docs/getting-started/deployment) for more information.
--- a/p2p-poll/app/app.vue
+++ b/p2p-poll/app/app.vue
@@ -0,0 +1,152 @@
+
+
+<style>
+/* Basic styling to make it look clean */
+body {
+  font-family: system-ui, -apple-system, sans-serif;
+  background-color: #f4f4f9;
+  color: #333;
+  margin: 0;
+  display: flex;
+  justify-content: center;
+  padding: 2rem;
+}
+
+.poll-container {
+  background: white;
+  padding: 2rem;
+  border-radius: 12px;
+  box-shadow: 0 4px 6px rgba(0,0,0,0.1);
+  width: 100%;
+  max-width: 500px;
+}
+
+header {
+  margin-bottom: 2rem;
+  text-align: center;
+}
+
+h1 { margin: 0 0 0.5rem 0; }
+
+.status {
+  font-size: 0.85rem;
+  color: #666;
+}
+.status .connected { color: #10b981; font-weight: bold; }
+
+.add-option-form {
+  display: flex;
+  gap: 0.5rem;
+  margin-bottom: 2rem;
+}
+
+input {
+  flex-grow: 1;
+  padding: 0.75rem;
+  border: 1px solid #ccc;
+  border-radius: 6px;
+  font-size: 1rem;
+}
+
+button {
+  background: #3b82f6;
+  color: white;
+  border: none;
+  padding: 0.75rem 1rem;
+  border-radius: 6px;
+  cursor: pointer;
+  font-weight: bold;
+  transition: background 0.2s;
+}
+
+button:hover { background: #2563eb; }
+
+.poll-list {
+  list-style: none;
+  padding: 0;
+  margin: 0;
+}
+
+.poll-item {
+  display: flex;
+  justify-content: space-between;
+  align-items: center;
+  padding: 1rem;
+  background: #f8fafc;
+  border: 1px solid #e2e8f0;
+  border-radius: 8px;
+  margin-bottom: 0.5rem;
+}
+
+.option-name { font-weight: 500; }
+.vote-section { display: flex; align-items: center; gap: 1rem; }
+.vote-count { font-size: 0.9rem; color: #475569; }
+.vote-btn { padding: 0.4rem 0.8rem; background: #10b981; }
+.vote-btn:hover { background: #059669; }
+.empty-state { text-align: center; color: #94a3b8; font-style: italic; }
+</style>
+<template>
+  <div class="poll-container">
+    <ClientOnly>
+      <header>
+        <h1>P2P Polling App 🗳️</h1>
+        <div class="status">
+          <span :class="{ 'connected': isConnected }">
+            ● {{ isConnected ? 'Synced' : 'Connecting...' }}
+          </span>
+          <span> | Peers online: {{ connectedPeers }}</span>
+        </div>
+      </header>
+
+      <main>
+        <form @submit.prevent="handleAddNewOption" class="add-option-form">
+          <input 
+            v-model="newOption" 
+            type="text" 
+            placeholder="Enter a new poll option..."
+            required
+          />
+          <button type="submit">Add Option</button>
+        </form>
+
+        <div v-if="Object.keys(pollData).length === 0" class="empty-state">
+          No options yet. Be the first to add one!
+        </div>
+
+        <ul v-else class="poll-list">
+          <li v-for="(votes, optionName) in pollData" :key="optionName" class="poll-item">
+            <span class="option-name">{{ optionName }}</span>
+            <div class="vote-section">
+              <span class="vote-count">{{ votes }} {{ votes === 1 ? 'vote' : 'votes' }}</span>
+              <button @click="vote(String(optionName))" class="vote-btn">+1</button>
+            </div>
+          </li>
+        </ul>
+      </main>
+      <template #fallback>
+        <div class="empty-state">Loading P2P Node...</div>
+      </template>
+    </ClientOnly>
+  </div>
+</template>
+
+<script setup lang="ts">
+import { ref } from 'vue';
+// Manually define 'global' for the browser
+if (process.client) {
+  (window as any).global = window;
+}
+import { usePoll } from '../composables/usePoll';
+
+// Because WebRTC requires the browser environment (window/navigator),
+// we ensure our composable only runs on the client side in Nuxt.
+const newOption = ref('');
+
+// Destructure our P2P logic
+const { pollData, isConnected, connectedPeers, addOption, vote } = usePoll();
+
+const handleAddNewOption = () => {
+  addOption(newOption.value);
+  newOption.value = ''; // Reset input
+};
+</script>
--- a/p2p-poll/composables/usePoll.ts
+++ b/p2p-poll/composables/usePoll.ts
@@ -0,0 +1,81 @@
+// composables/usePoll.ts
+import { ref, onMounted, onUnmounted } from 'vue';
+import * as Y from 'yjs';
+
+export const usePoll = () => {
+  // Reactive Vue state to drive the UI
+  const pollData = ref<Record<string, number>>({});
+  const isConnected = ref(false);
+  const connectedPeers = ref(1); // 1 = just you initially
+
+  let ydoc: Y.Doc;
+  let provider: any;
+  let yMap: Y.Map<number>;
+
+  onMounted(async () => {
+    // 1. Initialize the Yjs document
+    ydoc = new Y.Doc();
+
+    // 2. Connect via WebRTC. 
+    // 'nuxt-p2p-poll-demo-room' is the shared room name.
+    // Anyone using this exact string will sync together.
+    const { WebrtcProvider } = await import('y-webrtc');
+    provider = new WebrtcProvider('nuxt-p2p-poll-demo-room', ydoc);
+
+    // Track connection status
+    provider.on('synced', (arg: {synced: boolean}) => {
+      isConnected.value = arg.synced;
+    });
+
+    provider.on('peers', (data: any) => {
+      // data.webrtcPeers contains the connected peer IDs
+      connectedPeers.value = data.webrtcPeers.length + 1; // +1 for self
+    });
+
+    // 3. Define our shared state structure. We'll use a Map 
+    // where the Key is the Poll Option (string) and Value is the Vote Count (number)
+    yMap = ydoc.getMap<number>('shared-poll');
+
+    // 4. Listen for changes from other peers and update our Vue reactive state
+    yMap.observe(() => {
+      pollData.value = yMap.toJSON();
+    });
+
+    // Initial load in case data already exists in the room
+    pollData.value = yMap.toJSON();
+  });
+
+  onUnmounted(() => {
+    // Clean up when the component is destroyed
+    if (provider) {
+      provider.disconnect();
+    }
+    if (ydoc) {
+      ydoc.destroy();
+    }
+  });
+
+  // Action: Add a new option to the poll
+  const addOption = (optionName: string) => {
+    const trimmedName = optionName.trim();
+    if (trimmedName && !yMap.has(trimmedName)) {
+      yMap.set(trimmedName, 0); // Initialize with 0 votes
+    }
+  };
+
+  // Action: Vote for an existing option
+  const vote = (optionName: string) => {
+    if (yMap.has(optionName)) {
+      const currentVotes = yMap.get(optionName) || 0;
+      yMap.set(optionName, currentVotes + 1);
+    }
+  };
+
+  return {
+    pollData,
+    isConnected,
+    connectedPeers,
+    addOption,
+    vote
+  };
+};
--- a/p2p-poll/nuxt.config.ts
+++ b/p2p-poll/nuxt.config.ts
@@ -0,0 +1,11 @@
+// https://nuxt.com/docs/api/configuration/nuxt-config
+export default defineNuxtConfig({
+  compatibilityDate: '2025-07-15',
+  devtools: { enabled: true },
+  ssr: false,
+  vite: {
+    optimizeDeps: {
+      include: ['yjs', 'y-webrtc']
+    }
+  }
+})
--- a/p2p-poll/package-lock.json
+++ b/p2p-poll/package-lock.json
--- a/p2p-poll/package.json
+++ b/p2p-poll/package.json
@@ -0,0 +1,19 @@
+{
+  "name": "p2p-poll",
+  "type": "module",
+  "private": true,
+  "scripts": {
+    "build": "nuxt build",
+    "dev": "nuxt dev",
+    "generate": "nuxt generate",
+    "preview": "nuxt preview",
+    "postinstall": "nuxt prepare"
+  },
+  "dependencies": {
+    "nuxt": "^4.1.3",
+    "vue": "^3.5.30",
+    "vue-router": "^5.0.3",
+    "y-webrtc": "^10.3.0",
+    "yjs": "^13.6.30"
+  }
+}
--- a/p2p-poll/public/favicon.ico
+++ b/p2p-poll/public/favicon.ico
--- a/p2p-poll/public/robots.txt
+++ b/p2p-poll/public/robots.txt
@@ -0,0 +1,2 @@
+User-Agent: *
+Disallow:
--- a/p2p-poll/tsconfig.json
+++ b/p2p-poll/tsconfig.json
@@ -0,0 +1,18 @@
+{
+  // https://nuxt.com/docs/guide/concepts/typescript
+  "files": [],
+  "references": [
+    {
+      "path": "./.nuxt/tsconfig.app.json"
+    },
+    {
+      "path": "./.nuxt/tsconfig.server.json"
+    },
+    {
+      "path": "./.nuxt/tsconfig.shared.json"
+    },
+    {
+      "path": "./.nuxt/tsconfig.node.json"
+    }
+  ]
+}