* init p2p-poll

2026-03-18 20:09:20 +01:00
12 changed files with 10295 additions and 207 deletions
--- a/PollingApp.html
+++ b/PollingApp.html
@@ -1,200 +0,0 @@
 <!DOCTYPE html>
 <html lang="en">
 <head>
 <meta charset="UTF-8">
 <title>Peer‑to‑Peer Poll – up to 14 users (no vote loops)</title>
 <style>
  body {font-family:Arial,Helvetica,sans-serif; margin:20px;}
  #options li {margin:5px 0;}
  button {margin-left:5px;}
 </style>
 </head>
 <body>
 <h2>Peer‑to‑Peer Poll (max 14 participants)</h2>
 <div id="setup">
  <label>Your Peer ID: <input id="myId" readonly size="30"></label><br><br>
  <label>Room host ID (leave empty if you are the first client):
    <input id="hostId" placeholder="host peer id">
  </label>
  <button id="joinBtn">Join / Create Room</button>
  <p id="status"></p>
 </div>
 <hr>
 <h3>Poll</h3>
 <ul id="options"></ul>
 <input id="newOption" placeholder="New option text">
 <button id="addOptionBtn">Add option</button>
 <script src="https://unpkg.com/peerjs@1.5.4/dist/peerjs.min.js"></script>
 <script>
 /* ---------- 1. Initialise PeerJS ---------- */
 const peer = new Peer();                     // public signalling server
 const myIdInput = document.getElementById('myId');
 const statusEl   = document.getElementById('status');
 let isHost = false;                          // true for the first client
 let connections = [];                        // all open DataConnections
 let knownPeers = new Set();                  // IDs of every peer we know (including host)
 peer.on('open', id => {
  myIdInput.value = id;
  statusEl.textContent = 'Enter a host ID (or leave empty) and click Join.';
 });
 /* ---------- 2. Accept incoming connections (host side) ---------- */
 peer.on('connection', incoming => {
  registerConnection(incoming);
 });
 /* ---------- 3. Join / create a room ---------- */
 document.getElementById('joinBtn').onclick = () => {
  const hostId = document.getElementById('hostId').value.trim();
  if (hostId) {
    isHost = false;
    connectToPeer(hostId);
    statusEl.textContent = `Connecting to host ${hostId}…`;
  } else {
    isHost = true;
    knownPeers.add(peer.id);
    statusEl.textContent = 'Room created – share this Peer ID with others.';
  }
 };
 /* ---------- 4. Helper: connect to a remote peer ---------- */
 function connectToPeer(peerId) {
  if (knownPeers.has(peerId)) return;
  const conn = peer.connect(peerId);
  registerConnection(conn);
 }
 /* ---------- 5. Register a DataConnection ---------- */
 function registerConnection(conn) {
  if (!conn) return;
  connections.push(conn);
  knownPeers.add(conn.peer);
  conn.on('open', () => {
    // 1️⃣ Send full poll state
    conn.send({type: 'full', payload: poll, msgId: crypto.randomUUID()});
    // 2️⃣ If we are the host, tell the newcomer about other peers
    if (isHost) {
      const others = Array.from(knownPeers).filter(id => id !== conn.peer && id !== peer.id);
      if (others.length) conn.send({type: 'peer-list', payload: others, msgId: crypto.randomUUID()});
    }
  });
  conn.on('data', data => handleMessage(data, conn.peer));
  conn.on('close', () => {
    connections = connections.filter(c => c !== conn);
    knownPeers.delete(conn.peer);
  });
 }
 /* ---------- 6. Shared poll state ---------- */
 let poll = {options: []};   // each option: {id, text, votes}
 /* ---------- 7. Track my own votes ---------- */
 const myVotes = new Set();   // option.id values
 /* ---------- 8. Remember which messages we already processed ---------- */
 const seenMsgIds = new Set();
 /* ---------- 9. Broadcast helper (skip the sender) ---------- */
 function broadcast(msg, except = null) {
  connections.forEach(c => {
    if (c.open && c.peer !== except) c.send(msg);
  });
 }
 /* ---------- 10. Message handling ---------- */
 function handleMessage(msg, senderId) {
  // Ignore duplicates
  if (seenMsgIds.has(msg.msgId)) return;
  seenMsgIds.add(msg.msgId);
  switch (msg.type) {
    case 'full':
      poll = msg.payload;
      render();
      break;
    case 'add':
      poll.options.push(msg.payload);
      render();
      broadcast(msg, senderId);   // forward once
      break;
    case 'vote':
      const opt = poll.options.find(o => o.id === msg.payload.id);
      if (opt) opt.votes++;
      render();
      broadcast(msg, senderId);
      break;
    case 'peer-list':
      msg.payload.forEach(id => {
        if (id !== peer.id && !knownPeers.has(id)) connectToPeer(id);
      });
      break;
  }
 }
 /* ---------- 11. UI rendering ---------- */
 function render() {
  const ul = document.getElementById('options');
  ul.innerHTML = '';
  poll.options.forEach(opt => {
    const li = document.createElement('li');
    li.textContent = `${opt.text} – ${opt.votes} vote(s)`;
    const btn = document.createElement('button');
    btn.textContent = myVotes.has(opt.id) ? 'Voted' : 'Vote';
    btn.disabled = myVotes.has(opt.id);
    btn.onclick = () => {
      // Record locally – prevents double‑click on the same client
      myVotes.add(opt.id);
      btn.textContent = 'Voted';
      btn.disabled = true;
      const voteMsg = {
        type: 'vote',
        payload: {id: opt.id},
        msgId: crypto.randomUUID()
      };
      // Apply locally first
      opt.votes++;
      render();
      // Send to all peers
      broadcast(voteMsg);
    };
    li.appendChild(btn);
    ul.appendChild(li);
  });
 }
 /* ---------- 12. Add new option ---------- */
 document.getElementById('addOptionBtn').onclick = () => {
  const txt = document.getElementById('newOption').value.trim();
  if (!txt) return;
  const option = {id: crypto.randomUUID(), text: txt, votes: 0};
  poll.options.push(option);
  render();
  const addMsg = {
    type: 'add',
    payload: option,
    msgId: crypto.randomUUID()
  };
  broadcast(addMsg);
  document.getElementById('newOption').value = '';
 };
 </script>
 </body>
 </html>
--- a/README.md
+++ b/README.md
@@ -1,7 +1 @@
 # P2P Poll App
 This is a very simple polling app using peerjs.
 It runs as a single HTML file and can handle multiple users in one poll room.
 The app once open is self explanatory.
 App created with the help of GPTOSS120B.
--- a/p2p-poll/.gitignore
+++ b/p2p-poll/.gitignore
@@ -0,0 +1,24 @@
 # Nuxt dev/build outputs
 .output
 .data
 .nuxt
 .nitro
 .cache
 dist
 # Node dependencies
 node_modules
 # Logs
 logs
 *.log
 # Misc
 .DS_Store
 .fleet
 .idea
 # Local env files
 .env
 .env.*
 !.env.example
--- a/p2p-poll/README.md
+++ b/p2p-poll/README.md
@@ -0,0 +1,75 @@
 # Nuxt Minimal Starter
 Look at the [Nuxt documentation](https://nuxt.com/docs/getting-started/introduction) to learn more.
 ## Setup
 Make sure to install dependencies:
 ```bash
 # npm
 npm install
 # pnpm
 pnpm install
 # yarn
 yarn install
 # bun
 bun install
 ```
 ## Development Server
 Start the development server on `http://localhost:3000`:
 ```bash
 # npm
 npm run dev
 # pnpm
 pnpm dev
 # yarn
 yarn dev
 # bun
 bun run dev
 ```
 ## Production
 Build the application for production:
 ```bash
 # npm
 npm run build
 # pnpm
 pnpm build
 # yarn
 yarn build
 # bun
 bun run build
 ```
 Locally preview production build:
 ```bash
 # npm
 npm run preview
 # pnpm
 pnpm preview
 # yarn
 yarn preview
 # bun
 bun run preview
 ```
 Check out the [deployment documentation](https://nuxt.com/docs/getting-started/deployment) for more information.
--- a/p2p-poll/app/app.vue
+++ b/p2p-poll/app/app.vue
@@ -0,0 +1,152 @@
 <style>
 /* Basic styling to make it look clean */
 body {
  font-family: system-ui, -apple-system, sans-serif;
  background-color: #f4f4f9;
  color: #333;
  margin: 0;
  display: flex;
  justify-content: center;
  padding: 2rem;
 }
 .poll-container {
  background: white;
  padding: 2rem;
  border-radius: 12px;
  box-shadow: 0 4px 6px rgba(0,0,0,0.1);
  width: 100%;
  max-width: 500px;
 }
 header {
  margin-bottom: 2rem;
  text-align: center;
 }
 h1 { margin: 0 0 0.5rem 0; }
 .status {
  font-size: 0.85rem;
  color: #666;
 }
 .status .connected { color: #10b981; font-weight: bold; }
 .add-option-form {
  display: flex;
  gap: 0.5rem;
  margin-bottom: 2rem;
 }
 input {
  flex-grow: 1;
  padding: 0.75rem;
  border: 1px solid #ccc;
  border-radius: 6px;
  font-size: 1rem;
 }
 button {
  background: #3b82f6;
  color: white;
  border: none;
  padding: 0.75rem 1rem;
  border-radius: 6px;
  cursor: pointer;
  font-weight: bold;
  transition: background 0.2s;
 }
 button:hover { background: #2563eb; }
 .poll-list {
  list-style: none;
  padding: 0;
  margin: 0;
 }
 .poll-item {
  display: flex;
  justify-content: space-between;
  align-items: center;
  padding: 1rem;
  background: #f8fafc;
  border: 1px solid #e2e8f0;
  border-radius: 8px;
  margin-bottom: 0.5rem;
 }
 .option-name { font-weight: 500; }
 .vote-section { display: flex; align-items: center; gap: 1rem; }
 .vote-count { font-size: 0.9rem; color: #475569; }
 .vote-btn { padding: 0.4rem 0.8rem; background: #10b981; }
 .vote-btn:hover { background: #059669; }
 .empty-state { text-align: center; color: #94a3b8; font-style: italic; }
 </style>
 <template>
  <div class="poll-container">
    <ClientOnly>
      <header>
        <h1>P2P Polling App 🗳️</h1>
        <div class="status">
          <span :class="{ 'connected': isConnected }">
            ● {{ isConnected ? 'Synced' : 'Connecting...' }}
          </span>
          <span> | Peers online: {{ connectedPeers }}</span>
        </div>
      </header>
      <main>
        <form @submit.prevent="handleAddNewOption" class="add-option-form">
          <input 
            v-model="newOption" 
            type="text" 
            placeholder="Enter a new poll option..."
            required
          />
          <button type="submit">Add Option</button>
        </form>
        <div v-if="Object.keys(pollData).length === 0" class="empty-state">
          No options yet. Be the first to add one!
        </div>
        <ul v-else class="poll-list">
          <li v-for="(votes, optionName) in pollData" :key="optionName" class="poll-item">
            <span class="option-name">{{ optionName }}</span>
            <div class="vote-section">
              <span class="vote-count">{{ votes }} {{ votes === 1 ? 'vote' : 'votes' }}</span>
              <button @click="vote(String(optionName))" class="vote-btn">+1</button>
            </div>
          </li>
        </ul>
      </main>
      <template #fallback>
        <div class="empty-state">Loading P2P Node...</div>
      </template>
    </ClientOnly>
  </div>
 </template>
 <script setup lang="ts">
 import { ref } from 'vue';
 // Manually define 'global' for the browser
 if (process.client) {
  (window as any).global = window;
 }
 import { usePoll } from '../composables/usePoll';
 // Because WebRTC requires the browser environment (window/navigator),
 // we ensure our composable only runs on the client side in Nuxt.
 const newOption = ref('');
 // Destructure our P2P logic
 const { pollData, isConnected, connectedPeers, addOption, vote } = usePoll();
 const handleAddNewOption = () => {
  addOption(newOption.value);
  newOption.value = ''; // Reset input
 };
 </script>
--- a/p2p-poll/composables/usePoll.ts
+++ b/p2p-poll/composables/usePoll.ts
@@ -0,0 +1,81 @@
 // composables/usePoll.ts
 import { ref, onMounted, onUnmounted } from 'vue';
 import * as Y from 'yjs';
 export const usePoll = () => {
  // Reactive Vue state to drive the UI
  const pollData = ref<Record<string, number>>({});
  const isConnected = ref(false);
  const connectedPeers = ref(1); // 1 = just you initially
  let ydoc: Y.Doc;
  let provider: any;
  let yMap: Y.Map<number>;
  onMounted(async () => {
    // 1. Initialize the Yjs document
    ydoc = new Y.Doc();
    // 2. Connect via WebRTC. 
    // 'nuxt-p2p-poll-demo-room' is the shared room name.
    // Anyone using this exact string will sync together.
    const { WebrtcProvider } = await import('y-webrtc');
    provider = new WebrtcProvider('nuxt-p2p-poll-demo-room', ydoc);
    // Track connection status
    provider.on('synced', (arg: {synced: boolean}) => {
      isConnected.value = arg.synced;
    });
    provider.on('peers', (data: any) => {
      // data.webrtcPeers contains the connected peer IDs
      connectedPeers.value = data.webrtcPeers.length + 1; // +1 for self
    });
    // 3. Define our shared state structure. We'll use a Map 
    // where the Key is the Poll Option (string) and Value is the Vote Count (number)
    yMap = ydoc.getMap<number>('shared-poll');
    // 4. Listen for changes from other peers and update our Vue reactive state
    yMap.observe(() => {
      pollData.value = yMap.toJSON();
    });
    // Initial load in case data already exists in the room
    pollData.value = yMap.toJSON();
  });
  onUnmounted(() => {
    // Clean up when the component is destroyed
    if (provider) {
      provider.disconnect();
    }
    if (ydoc) {
      ydoc.destroy();
    }
  });
  // Action: Add a new option to the poll
  const addOption = (optionName: string) => {
    const trimmedName = optionName.trim();
    if (trimmedName && !yMap.has(trimmedName)) {
      yMap.set(trimmedName, 0); // Initialize with 0 votes
    }
  };
  // Action: Vote for an existing option
  const vote = (optionName: string) => {
    if (yMap.has(optionName)) {
      const currentVotes = yMap.get(optionName) || 0;
      yMap.set(optionName, currentVotes + 1);
    }
  };
  return {
    pollData,
    isConnected,
    connectedPeers,
    addOption,
    vote
  };
 };
--- a/p2p-poll/nuxt.config.ts
+++ b/p2p-poll/nuxt.config.ts
@@ -0,0 +1,11 @@
 // https://nuxt.com/docs/api/configuration/nuxt-config
 export default defineNuxtConfig({
  compatibilityDate: '2025-07-15',
  devtools: { enabled: true },
  ssr: false,
  vite: {
    optimizeDeps: {
      include: ['yjs', 'y-webrtc']
    }
  }
 })
--- a/p2p-poll/package-lock.json
+++ b/p2p-poll/package-lock.json
--- a/p2p-poll/package.json
+++ b/p2p-poll/package.json
@@ -0,0 +1,19 @@
 {
  "name": "p2p-poll",
  "type": "module",
  "private": true,
  "scripts": {
    "build": "nuxt build",
    "dev": "nuxt dev",
    "generate": "nuxt generate",
    "preview": "nuxt preview",
    "postinstall": "nuxt prepare"
  },
  "dependencies": {
    "nuxt": "^4.1.3",
    "vue": "^3.5.30",
    "vue-router": "^5.0.3",
    "y-webrtc": "^10.3.0",
    "yjs": "^13.6.30"
  }
 }
--- a/p2p-poll/public/favicon.ico
+++ b/p2p-poll/public/favicon.ico
--- a/p2p-poll/public/robots.txt
+++ b/p2p-poll/public/robots.txt
@@ -0,0 +1,2 @@
 User-Agent: *
 Disallow:
--- a/p2p-poll/tsconfig.json
+++ b/p2p-poll/tsconfig.json
@@ -0,0 +1,18 @@
 {
  // https://nuxt.com/docs/guide/concepts/typescript
  "files": [],
  "references": [
    {
      "path": "./.nuxt/tsconfig.app.json"
    },
    {
      "path": "./.nuxt/tsconfig.server.json"
    },
    {
      "path": "./.nuxt/tsconfig.shared.json"
    },
    {
      "path": "./.nuxt/tsconfig.node.json"
    }
  ]
 }